Structure of PDB 4eox Chain P Binding Site BS01 |
|
|
Ligand ID | 0S5 |
InChI | InChI=1S/C22H29N3O5/c26-15-24(30)14-18(13-16-7-4-5-8-16)22(29)25-12-6-11-19(25)21(28)23-20(27)17-9-2-1-3-10-17/h1-3,9-10,15-16,18-19,30H,4-8,11-14H2,(H,23,27,28)/t18-,19+/m1/s1 |
InChIKey | JPSWIPZHYDYDLN-MOPGFXCFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NC(=O)c1ccccc1)C3N(C(=O)C(CC2CCCC2)CN(O)C=O)CCC3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(=O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC3CCCC3)CN(C=O)O | CACTVS 3.370 | ON(C[CH](CC1CCCC1)C(=O)N2CCC[CH]2C(=O)NC(=O)c3ccccc3)C=O | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(=O)NC(=O)C2CCCN2C(=O)C(CC3CCCC3)CN(C=O)O | CACTVS 3.370 | ON(C[C@@H](CC1CCCC1)C(=O)N2CCC[C@H]2C(=O)NC(=O)c3ccccc3)C=O |
|
Formula | C22 H29 N3 O5 |
Name | N-benzoyl-1-[(2R)-3-cyclopentyl-2-{[formyl(hydroxy)amino]methyl}propanoyl]-L-prolinamide |
ChEMBL | CHEMBL2032119 |
DrugBank | |
ZINC | ZINC000034873861
|
PDB chain | 4eox Chain P Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.88: peptide deformylase. |
|
|
|