Structure of PDB 4zbi Chain K Binding Site BS01 |
|
|
Ligand ID | 4M6 |
InChI | InChI=1S/C25H23NO3/c27-25(28)24-21(20-12-3-9-18-10-5-15-26(24)23(18)20)13-6-16-29-22-14-4-8-17-7-1-2-11-19(17)22/h1-4,7-9,11-12,14H,5-6,10,13,15-16H2,(H,27,28) |
InChIKey | XOMAOOTVWOCYAD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1n2CCCc3cccc(c1CCCOc4cccc5ccccc45)c23 | ACDLabs 12.01 | OC(c3n1CCCc2c1c(ccc2)c3CCCOc5c4ccccc4ccc5)=O | OpenEye OEToolkits 1.9.2 | c1ccc2c(c1)cccc2OCCCc3c4cccc5c4n(c3C(=O)O)CCC5 |
|
Formula | C25 H23 N O3 |
Name | 1-[3-(naphthalen-1-yloxy)propyl]-5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-2-carboxylic acid |
ChEMBL | CHEMBL3426319 |
DrugBank | |
ZINC | ZINC000231428798
|
PDB chain | 4zbi Chain K Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|