Structure of PDB 4r00 Chain K Binding Site BS01 |
|
|
Ligand ID | SLA |
InChI | InChI=1S/C10H17NO4/c1-5(2)7(13)10(4-12)8(14)6(3)9(15)11-10/h4-8,13-14H,1-3H3,(H,11,15)/t6-,7+,8+,10-/m1/s1 |
InChIKey | NREVXJAQSWMFJZ-CHIQAWFVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@@H]1[C@@H]([C@@](NC1=O)(C=O)[C@H](C(C)C)O)O | CACTVS 3.385 | CC(C)[C@H](O)[C@]1(NC(=O)[C@H](C)[C@@H]1O)C=O | OpenEye OEToolkits 1.7.6 | CC1C(C(NC1=O)(C=O)C(C(C)C)O)O | CACTVS 3.385 | CC(C)[CH](O)[C]1(NC(=O)[CH](C)[CH]1O)C=O | ACDLabs 12.01 | O=CC1(NC(=O)C(C1O)C)C(O)C(C)C |
|
Formula | C10 H17 N O4 |
Name | Omuralide, open form; (2R,3S,4R)-3-hydroxy-2-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-5-oxopyrrolidine-2-carbaldehyde |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209411
|
PDB chain | 4r00 Chain K Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|