Structure of PDB 8gk3 Chain J Binding Site BS01 |
|
|
Ligand ID | ZWY |
InChI | InChI=1S/C19H28O5S/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h3,13-16H,4-11H2,1-2H3,(H,21,22,23)/t13-,14-,15-,16-,18-,19-/m0/s1 |
InChIKey | CZWCKYRVOZZJNM-USOAJAOKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@H](CC[C@]34C)O[S](O)(=O)=O)[C@@H]1CCC2=O | OpenEye OEToolkits 2.0.7 | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C | CACTVS 3.385 | C[C]12CC[CH]3[CH](CC=C4C[CH](CC[C]34C)O[S](O)(=O)=O)[CH]1CCC2=O | OpenEye OEToolkits 2.0.7 | CC12CCC3C(C1CCC2=O)CC=C4C3(CCC(C4)OS(=O)(=O)O)C | ACDLabs 12.01 | O=S(=O)(O)OC1CCC2(C)C3CCC4(C)C(CCC4=O)C3CC=C2C1 |
|
Formula | C19 H28 O5 S |
Name | 17-oxoandrost-5-en-3beta-yl hydrogen sulfate; Dehydroepiandrosterone sulfate; DHEA sulfate; DHEA-S |
ChEMBL | CHEMBL259898 |
DrugBank | DB05804 |
ZINC | ZINC000004096458
|
PDB chain | 8gk3 Chain A Residue 603
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.14.1: unspecific monooxygenase. |
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0008395 |
steroid hydroxylase activity |
GO:0008401 |
retinoic acid 4-hydroxylase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0019825 |
oxygen binding |
GO:0020037 |
heme binding |
GO:0046872 |
metal ion binding |
GO:0050649 |
testosterone 6-beta-hydroxylase activity |
GO:0062183 |
all-trans retinoic acid 18-hydroxylase activity |
GO:0070330 |
aromatase activity |
GO:0101020 |
estrogen 16-alpha-hydroxylase activity |
GO:0101021 |
estrogen 2-hydroxylase activity |
|
|