Structure of PDB 5ejd Chain J Binding Site BS01 |
|
|
Ligand ID | 5PD |
InChI | InChI=1S/C11H23N2O6PS/c1-11(2,7-19-20(17)18)9(15)10(16)13-4-3-8(14)12-5-6-21/h9,15,20-21H,3-7H2,1-2H3,(H,12,14)(H,13,16)(H,17,18)/t9-/m0/s1 |
InChIKey | YXOTVSUMWFLVRX-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(CO[PH](O)=O)[C@@H](O)C(=O)NCCC(=O)NCCS | OpenEye OEToolkits 2.0.4 | CC(C)(COP(=O)O)C(C(=O)NCCC(=O)NCCS)O | OpenEye OEToolkits 2.0.4 | CC(C)(COP(=O)O)[C@H](C(=O)NCCC(=O)NCCS)O | CACTVS 3.385 | CC(C)(CO[PH](O)=O)[CH](O)C(=O)NCCC(=O)NCCS |
|
Formula | C11 H23 N2 O6 P S |
Name | (R)-3-hydroxy-4-((3-((2-mercaptoethyl)amino)-3-oxopropyl)amino)-2,2-dimethyl-4-oxobutyl hydrogen phosphonate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905044
|
PDB chain | 5ejd Chain I Residue 101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|