Structure of PDB 4a97 Chain J Binding Site BS01 |
|
|
Ligand ID | ZPC |
InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3/t16-/m1/s1 |
InChIKey | GBBSUAFBMRNDJC-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN1CCN(CC1)C(=O)OC2c3c(nccn3)C(=O)N2c4ccc(cn4)Cl | ACDLabs 12.01 | O=C(OC3c1nccnc1C(=O)N3c2ncc(Cl)cc2)N4CCN(C)CC4 | CACTVS 3.370 | CN1CCN(CC1)C(=O)O[CH]2N(C(=O)c3nccnc23)c4ccc(Cl)cn4 | OpenEye OEToolkits 1.7.6 | CN1CCN(CC1)C(=O)O[C@@H]2c3c(nccn3)C(=O)N2c4ccc(cn4)Cl | CACTVS 3.370 | CN1CCN(CC1)C(=O)O[C@H]2N(C(=O)c3nccnc23)c4ccc(Cl)cn4 |
|
Formula | C17 H17 Cl N6 O3 |
Name | (5R)-6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate; R-ZOPICLONE |
ChEMBL | CHEMBL250053 |
DrugBank | |
ZINC | ZINC000019632839
|
PDB chain | 4a97 Chain F Residue 1318
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|