Structure of PDB 2yme Chain J Binding Site BS01 |
|
|
Ligand ID | CWB |
InChI | InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14- |
InChIKey | MFWNKCLOYSRHCJ-BTTYYORXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1[C@@H]2CCC[C@H]1CC(C2)NC(=O)c3nn(C)c4ccccc34 | ACDLabs 12.01 | O=C(c2nn(c1ccccc12)C)NC4CC3N(C)C(CCC3)C4 | OpenEye OEToolkits 1.9.2 | Cn1c2ccccc2c(n1)C(=O)NC3C[C@H]4CCC[C@@H](C3)N4C | OpenEye OEToolkits 1.9.2 | Cn1c2ccccc2c(n1)C(=O)NC3CC4CCCC(C3)N4C | CACTVS 3.385 | CN1[CH]2CCC[CH]1CC(C2)NC(=O)c3nn(C)c4ccccc34 |
|
Formula | C18 H24 N4 O |
Name | 1-methyl-N-[(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide; GRANISETRON |
ChEMBL | CHEMBL1290003 |
DrugBank | DB00889 |
ZINC | ZINC000100018854
|
PDB chain | 2yme Chain I Residue 1207
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|