Structure of PDB 8qyf Chain I Binding Site BS01 |
|
|
Ligand ID | 6V8 |
InChI | InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
InChIKey | MXAYKZJJDUDWDS-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B(O)O | OpenEye OEToolkits 2.0.5 | B(C(CC(C)C)NC(=O)CNC(=O)c1cc(ccc1Cl)Cl)(O)O | OpenEye OEToolkits 2.0.5 | B([C@H](CC(C)C)NC(=O)CNC(=O)c1cc(ccc1Cl)Cl)(O)O | CACTVS 3.385 | CC(C)C[CH](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B(O)O |
|
Formula | C14 H19 B Cl2 N2 O4 |
Name | [(1~{R})-1-[2-[[2,5-bis(chloranyl)phenyl]carbonylamino]ethanoylamino]-3-methyl-butyl]boronic acid |
ChEMBL | CHEMBL2141296 |
DrugBank | DB09570 |
ZINC | ZINC000169946773
|
PDB chain | 8qyf Chain I Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.92: endopeptidase Clp. |
|
|
|