Structure of PDB 7eg3 Chain I Binding Site BS01 |
|
|
Ligand ID | J2U |
InChI | InChI=1S/C29H24O3/c30-25-10-6-20(7-11-25)15-24-18-27-23(14-19-4-2-1-3-5-19)16-22(17-28(27)29(24)32)21-8-12-26(31)13-9-21/h1-13,16-17,24,30-31H,14-15,18H2/t24-/m0/s1 |
InChIKey | BBBVODRPSLPZKR-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc(C[CH]2Cc3c(Cc4ccccc4)cc(cc3C2=O)c5ccc(O)cc5)cc1 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Cc2cc(cc3c2CC(C3=O)Cc4ccc(cc4)O)c5ccc(cc5)O | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Cc2cc(cc3c2C[C@@H](C3=O)Cc4ccc(cc4)O)c5ccc(cc5)O | CACTVS 3.385 | Oc1ccc(C[C@H]2Cc3c(Cc4ccccc4)cc(cc3C2=O)c5ccc(O)cc5)cc1 |
|
Formula | C29 H24 O3 |
Name | (2~{S})-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-4-(phenylmethyl)-2,3-dihydroinden-1-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7eg3 Chain I Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|