Structure of PDB 4zbf Chain I Binding Site BS01 |
|
|
Ligand ID | 4M7 |
InChI | InChI=1S/C25H23NO4S/c27-25(28)24-20(19-10-4-13-22-23(19)26(24)14-6-16-31(22)29)11-5-15-30-21-12-3-8-17-7-1-2-9-18(17)21/h1-4,7-10,12-13H,5-6,11,14-16H2,(H,27,28)/t31-/m1/s1 |
InChIKey | RWBITVLVWMQUOJ-WJOKGBTCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1ccc2c(c1)cccc2OCCCc3c4cccc5c4n(c3C(=O)O)CCCS5=O | CACTVS 3.385 | OC(=O)c1n2CCC[S@@](=O)c3cccc(c1CCCOc4cccc5ccccc45)c23 | ACDLabs 12.01 | OC(c1c(c3c2n1CCCS(=O)c2ccc3)CCCOc4cccc5c4cccc5)=O | CACTVS 3.385 | OC(=O)c1n2CCC[S](=O)c3cccc(c1CCCOc4cccc5ccccc45)c23 |
|
Formula | C25 H23 N O4 S |
Name | (1R)-7-[3-(naphthalen-1-yloxy)propyl]-3,4-dihydro-2H-[1,4]thiazepino[2,3,4-hi]indole-6-carboxylic acid 1-oxide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4zbf Chain I Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|