Structure of PDB 7lun Chain H Binding Site BS01 |
|
|
Ligand ID | YFG |
InChI | InChI=1S/C20H26FN3O2S/c21-16-9-13(22-12-3-1-2-4-12)10-17-19(16)20(26)24-18(23-17)11-27-15-7-5-14(25)6-8-15/h9-10,12,14-15,22,25H,1-8,11H2,(H,23,24,26)/t14-,15- |
InChIKey | FUHIIFURQIAPDZ-SHTZXODSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C1CC(CCC1SCC3=Nc2cc(cc(c2C(N3)=O)F)NC4CCCC4)O | CACTVS 3.385 | O[CH]1CC[CH](CC1)SCC2=Nc3cc(NC4CCCC4)cc(F)c3C(=O)N2 | CACTVS 3.385 | O[C@@H]1CC[C@H](CC1)SCC2=Nc3cc(NC4CCCC4)cc(F)c3C(=O)N2 | OpenEye OEToolkits 2.0.7 | c1c(cc(c2c1N=C(NC2=O)CSC3CCC(CC3)O)F)NC4CCCC4 |
|
Formula | C20 H26 F N3 O2 S |
Name | 7-(cyclopentylamino)-5-fluoro-2-{[(trans-4-hydroxycyclohexyl)sulfanyl]methyl}quinazolin-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7lun Chain H Residue 1901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|