Structure of PDB 7eg2 Chain H Binding Site BS01 |
|
|
Ligand ID | J2X |
InChI | InChI=1S/C30H26O4/c31-19-30(17-21-6-10-25(32)11-7-21)18-28-24(14-20-4-2-1-3-5-20)15-23(16-27(28)29(30)34)22-8-12-26(33)13-9-22/h1-13,15-16,31-33H,14,17-19H2/t30-/m0/s1 |
InChIKey | OCWYWPXFECTDDD-PMERELPUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@]1(Cc2ccc(O)cc2)Cc3c(Cc4ccccc4)cc(cc3C1=O)c5ccc(O)cc5 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Cc2cc(cc3c2CC(C3=O)(Cc4ccc(cc4)O)CO)c5ccc(cc5)O | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Cc2cc(cc3c2C[C@@](C3=O)(Cc4ccc(cc4)O)CO)c5ccc(cc5)O | CACTVS 3.385 | OC[C]1(Cc2ccc(O)cc2)Cc3c(Cc4ccccc4)cc(cc3C1=O)c5ccc(O)cc5 |
|
Formula | C30 H26 O4 |
Name | (2~{S})-2-(hydroxymethyl)-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-4-(phenylmethyl)-3~{H}-inden-1-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7eg2 Chain H Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|