Structure of PDB 6g7f Chain H Binding Site BS01 |
|
|
Ligand ID | EPW |
InChI | InChI=1S/C17H30N2O7/c1-7(2)10(16(23)24)13(20)15(22)18-11(8(3)4)14(21)19-12(9(5)6)17(25)26/h7-13,20H,1-6H3,(H,18,22)(H,19,21)(H,23,24)(H,25,26)/t10-,11-,12-,13+/m0/s1 |
InChIKey | AEDSWBBILSEDHQ-ZDEQEGDKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](O)[C@H](C(C)C)C(O)=O)C(C)C)C(O)=O | CACTVS 3.385 | CC(C)[CH](NC(=O)[CH](NC(=O)[CH](O)[CH](C(C)C)C(O)=O)C(C)C)C(O)=O | OpenEye OEToolkits 2.0.6 | CC(C)C(C(C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)O)O)C(=O)O | OpenEye OEToolkits 2.0.6 | CC(C)[C@@H]([C@H](C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)O)O)C(=O)O |
|
Formula | C17 H30 N2 O7 |
Name | Cystargolide B- bound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6g7f Chain H Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|