Structure of PDB 5jyx Chain H Binding Site BS01 |
|
|
Ligand ID | GD1 |
InChI | InChI=1S/C7H7N5O/c8-1-3-2-10-5-4(3)6(13)12-7(9)11-5/h1-2,8H,(H4,9,10,11,12,13)/b8-1- |
InChIKey | BETPBINTBSWYLZ-QPIMQUGISA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1c2c(cnc2N=C(N)N1)C=[N@H] | OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)N=C(NC2=O)N)C=N | CACTVS 3.370 | NC1=Nc2[nH]cc(C=N)c2C(=O)N1 | OpenEye OEToolkits 1.7.6 | [H]/N=C\c1c[nH]c2c1C(=O)NC(=N2)N |
|
Formula | C7 H7 N5 O |
Name | 2-amino-5-[(Z)-iminomethyl]-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one; 7-cyano-7-deazaguanine, bound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5jyx Chain D Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|