Structure of PDB 4z1l Chain H Binding Site BS01 |
|
|
Ligand ID | 4KF |
InChI | InChI=1S/C17H25NO6/c1-5-10(2)14(17(21)22)15(19)16(20)18-9-11-6-12(23-3)8-13(7-11)24-4/h6-8,10,14-15,19H,5,9H2,1-4H3,(H,18,20)(H,21,22)/t10-,14-,15+/m0/s1 |
InChIKey | JPJPTFSEVLSNJM-NZVBXONLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1c(OC)cc(cc1CNC(C(C(C(=O)O)C(CC)C)O)=O)OC | OpenEye OEToolkits 1.9.2 | CC[C@H](C)[C@@H]([C@H](C(=O)NCc1cc(cc(c1)OC)OC)O)C(=O)O | CACTVS 3.385 | CC[CH](C)[CH]([CH](O)C(=O)NCc1cc(OC)cc(OC)c1)C(O)=O | OpenEye OEToolkits 1.9.2 | CCC(C)C(C(C(=O)NCc1cc(cc(c1)OC)OC)O)C(=O)O | CACTVS 3.385 | CC[C@H](C)[C@@H]([C@@H](O)C(=O)NCc1cc(OC)cc(OC)c1)C(O)=O |
|
Formula | C17 H25 N O6 |
Name | (2S,3S)-2-{(1R)-2-[(3,5-dimethoxybenzyl)amino]-1-hydroxy-2-oxoethyl}-3-methylpentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230507362
|
PDB chain | 4z1l Chain H Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|