Structure of PDB 4xcy Chain H Binding Site BS01 |
|
|
Ligand ID | 44G |
InChI | InChI=1S/C18H35O10P/c1-3-5-7-9-17(21)25-13-16(28-18(22)10-8-6-4-2)14-27-29(23,24)26-12-15(20)11-19/h15-16,19-20H,3-14H2,1-2H3,(H,23,24)/t15-,16+/m1/s1 |
InChIKey | CNAHGDCINXNHER-CVEARBPZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCC(=O)OC[C@@H](CO[P](O)(=O)OC[C@H](O)CO)OC(=O)CCCCC | OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OC[C@@H](COP(=O)(O)OC[C@@H](CO)O)OC(=O)CCCCC | OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OCC(COP(=O)(O)OCC(CO)O)OC(=O)CCCCC | ACDLabs 12.01 | O=C(OC(COP(=O)(OCC(O)CO)O)COC(=O)CCCCC)CCCCC | CACTVS 3.385 | CCCCCC(=O)OC[CH](CO[P](O)(=O)OC[CH](O)CO)OC(=O)CCCCC |
|
Formula | C18 H35 O10 P |
Name | (2S)-3-{[(R)-{[(2R)-2,3-dihydroxypropyl]oxy}(hydroxy)phosphoryl]oxy}-2-(hexanoyloxy)propyl hexanoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033971124
|
PDB chain | 4xcy Chain H Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|