Structure of PDB 4jls Chain H Binding Site BS01 |
|
|
Ligand ID | 3ZE |
InChI | InChI=1S/C11H15N6O6P/c12-11-14-9-8(10(20)15-11)13-4-17(9)5-1-16(2-6(5)18)7(19)3-24(21,22)23/h4-6,18H,1-3H2,(H2,21,22,23)(H3,12,14,15,20)/t5-,6+/m0/s1 |
InChIKey | PIHCTBQWWHFPNB-NTSWFWBYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=Nc2n(cnc2C(=O)N1)[C@H]3CN(C[C@H]3O)C(=O)C[P](O)(O)=O | ACDLabs 12.01 | O=C(N3CC(n1c2N=C(N)NC(=O)c2nc1)C(O)C3)CP(=O)(O)O | OpenEye OEToolkits 1.7.6 | c1nc2c(n1[C@H]3CN(C[C@H]3O)C(=O)CP(=O)(O)O)N=C(NC2=O)N | CACTVS 3.385 | NC1=Nc2n(cnc2C(=O)N1)[CH]3CN(C[CH]3O)C(=O)C[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | c1nc2c(n1C3CN(CC3O)C(=O)CP(=O)(O)O)N=C(NC2=O)N |
|
Formula | C11 H15 N6 O6 P |
Name | {2-[(3S,4R)-3-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-4-hydroxypyrrolidin-1-yl]-2-oxoethyl}phosphonic acid |
ChEMBL | CHEMBL2420978 |
DrugBank | |
ZINC | ZINC000096913403
|
PDB chain | 4jls Chain H Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.4.2.- 2.4.2.22: xanthine phosphoribosyltransferase. |
|
|
|