Structure of PDB 4isk Chain H Binding Site BS01 |
|
|
Ligand ID | UMC |
InChI | InChI=1S/C9H15N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h5-6,8,12H,1-4H2,(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
InChIKey | WQQZADPPRABIFU-SHYZEUOFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O[CH]1C[CH](O[CH]1CO[P](O)(O)=O)N2CCC(=O)NC2=O | OpenEye OEToolkits 1.7.6 | C1CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)O)O | ACDLabs 12.01 | O=P(O)(O)OCC2OC(N1C(=O)NC(=O)CC1)CC2O | CACTVS 3.370 | O[C@H]1C[C@@H](O[C@@H]1CO[P](O)(O)=O)N2CCC(=O)NC2=O | OpenEye OEToolkits 1.7.6 | C1CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)O |
|
Formula | C9 H15 N2 O8 P |
Name | 2'-deoxy-5'-uridylic acid |
ChEMBL | CHEMBL3144338 |
DrugBank | |
ZINC |
|
PDB chain | 4isk Chain H Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|