Structure of PDB 3n8k Chain H Binding Site BS01 |
|
|
Ligand ID | D1X |
InChI | InChI=1S/C6H5NO4/c8-4-1-3(6(10)11)2-5(9)7-4/h1H,2H2,(H,10,11)(H,7,8,9) |
InChIKey | RELAYXOQOWYDAT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C1C(=CC(=O)NC1=O)C(=O)O | CACTVS 3.370 | OC(=O)C1=CC(=O)NC(=O)C1 | ACDLabs 12.01 | O=C1NC(=O)C=C(C(=O)O)C1 |
|
Formula | C6 H5 N O4 |
Name | 2,6-dioxo-1,2,3,6-tetrahydropyridine-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000038787894
|
PDB chain | 3n8k Chain H Residue 147
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|