Structure of PDB 3h06 Chain H Binding Site BS01 |
|
|
Ligand ID | VBP |
InChI | InChI=1S/C15H15N3O6/c16-11(14(22)23)8-17-6-5-12(19)18(15(17)24)7-9-1-3-10(4-2-9)13(20)21/h1-6,11H,7-8,16H2,(H,20,21)(H,22,23)/t11-/m1/s1 |
InChIKey | XLRLZPOBHPIDFX-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[C@H](CN1C=CC(=O)N(Cc2ccc(cc2)C(O)=O)C1=O)C(O)=O | OpenEye OEToolkits 1.5.0 | c1cc(ccc1CN2C(=O)C=CN(C2=O)CC(C(=O)O)N)C(=O)O | ACDLabs 10.04 | O=C(O)c1ccc(cc1)CN2C(=O)C=CN(C2=O)CC(N)C(=O)O | OpenEye OEToolkits 1.5.0 | c1cc(ccc1CN2C(=O)C=CN(C2=O)C[C@H](C(=O)O)N)C(=O)O | CACTVS 3.341 | N[CH](CN1C=CC(=O)N(Cc2ccc(cc2)C(O)=O)C1=O)C(O)=O |
|
Formula | C15 H15 N3 O6 |
Name | 4-({3-[(2R)-2-amino-2-carboxyethyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}methyl)benzoic acid; (S)-1-(2-amino-2-carboxyethyl)-3-(4-carboxybenzyl)pyrimidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3h06 Chain H Residue 806
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|