Structure of PDB 2fir Chain H Binding Site BS01 |
|
|
Ligand ID | 0G7 |
InChI | InChI=1S/C21H31ClN6O3/c22-13-18(29)16(8-4-10-26-21(24)25)27-19(30)17-9-5-11-28(17)20(31)15(23)12-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13,23H2,(H,27,30)(H4,24,25,26)/t15-,16+,17+/m1/s1 |
InChIKey | KWPACVJPAFGBEQ-IKGGRYGDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | c1ccc(cc1)CC(C(=O)N2CCCC2C(=O)NC(CCCNC(=N)N)C(=O)CCl)N | CACTVS 3.385 | N[CH](Cc1ccccc1)C(=O)N2CCC[CH]2C(=O)N[CH](CCCNC(N)=N)C(=O)CCl | OpenEye OEToolkits 1.7.5 | [H]/N=C(\N)/NCCC[C@@H](C(=O)CCl)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](Cc2ccccc2)N | CACTVS 3.385 | N[C@H](Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(N)=N)C(=O)CCl | ACDLabs 12.01 | O=C(NC(C(=O)CCl)CCCNC(=[N@H])N)C2N(C(=O)C(N)Cc1ccccc1)CCC2 |
|
Formula | C21 H31 Cl N6 O3 |
Name | D-phenylalanyl-N-[(3S)-6-carbamimidamido-1-chloro-2-oxohexan-3-yl]-L-prolinamide; d-Phe-Pro-Arg chloromethylketone (PPACK) |
ChEMBL | CHEMBL307440 |
DrugBank | |
ZINC | ZINC000026376363
|
PDB chain | 2fir Chain H Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.21: coagulation factor VIIa. |
|
|
|