Structure of PDB 2c9b Chain H Binding Site BS01 |
|
|
Ligand ID | PUG |
InChI | InChI=1S/C10H14N4O7/c15-2-4(17)6(18)3(16)1-14-7-5(11-10(14)21)8(19)13-9(20)12-7/h3-4,6,15-18H,1-2H2,(H,11,21)(H2,12,13,19,20)/t3-,4-,6+/m1/s1 |
InChIKey | XIBHHWBJHOTHGZ-KODRXGBYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C(C(C(C(CO)O)O)O)N1C2=C(C(=O)NC(=O)N2)NC1=O | ACDLabs 10.04 | O=C1C2=C(NC(=O)N1)N(C(=O)N2)CC(O)C(O)C(O)CO | CACTVS 3.341 | OC[CH](O)[CH](O)[CH](O)CN1C(=O)NC2=C1NC(=O)NC2=O | OpenEye OEToolkits 1.5.0 | C([C@H]([C@@H]([C@@H](CO)O)O)O)N1C2=C(C(=O)NC(=O)N2)NC1=O | CACTVS 3.341 | OC[C@@H](O)[C@@H](O)[C@H](O)CN1C(=O)NC2=C1NC(=O)NC2=O |
|
Formula | C10 H14 N4 O7 |
Name | 3-(1,3,7-TRIHYDRO-9-D-RIBITYL-2,6,8-PURINETRIONE-7-YL) |
ChEMBL | CHEMBL1235497 |
DrugBank | |
ZINC | ZINC000058650741
|
PDB chain | 2c9b Chain H Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H89 |
Catalytic site (residue number reindexed from 1) |
H75 |
Enzyme Commision number |
2.5.1.78: 6,7-dimethyl-8-ribityllumazine synthase. |
|
|
|