Structure of PDB 1eei Chain H Binding Site BS01 |
|
|
Ligand ID | GAA |
InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-2-6(4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12+/m1/s1 |
InChIKey | VCCMGHVCRFMITI-IIRVCBMXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@H]1O[C@H](Oc2cccc(c2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)OC2C(C(C(C(O2)CO)O)O)O)[N+](=O)[O-] | ACDLabs 10.04 | [O-][N+](=O)c2cc(OC1OC(C(O)C(O)C1O)CO)ccc2 | CACTVS 3.341 | OC[CH]1O[CH](Oc2cccc(c2)[N+]([O-])=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)[N+](=O)[O-] |
|
Formula | C12 H15 N O8 |
Name | 3-nitrophenyl alpha-D-galactopyranoside; METANITROPHENYL-ALPHA-D-GALACTOSIDE; 3-nitrophenyl alpha-D-galactoside; 3-nitrophenyl D-galactoside; 3-nitrophenyl galactoside |
ChEMBL | |
DrugBank | DB02213 |
ZINC | ZINC000006535005
|
PDB chain | 1eei Chain H Residue 508
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|