Structure of PDB 7pnb Chain G Binding Site BS01 |
|
|
Ligand ID | YZT |
InChI | InChI=1S/C6H12O8S/c7-3-2(1-15(11,12)13)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
InChIKey | QFBWOLBPVQLZEH-VFUOTHLCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)S(=O)(=O)O | OpenEye OEToolkits 1.7.6 | C(C1C(C(C(C(O1)O)O)O)O)S(=O)(=O)O | ACDLabs 12.01 | O=S(=O)(O)CC1OC(O)C(O)C(O)C1O | CACTVS 3.370 | O[CH]1O[CH](C[S](O)(=O)=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.370 | O[C@@H]1O[C@H](C[S](O)(=O)=O)[C@@H](O)[C@H](O)[C@H]1O |
|
Formula | C6 H12 O8 S |
Name | 6-deoxy-6-sulfo-beta-D-glucopyranose |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7pnb Chain q Residue 3
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|