Structure of PDB 5bkk Chain G Binding Site BS01 |
|
|
Ligand ID | YQ4 |
InChI | InChI=1S/C26H40NO/c1-4-7-19-27(20-8-5-2,21-9-6-3)22-23-15-17-25(18-16-23)26(28)24-13-11-10-12-14-24/h10-18,26,28H,4-9,19-22H2,1-3H3/t26-/m1/s1 |
InChIKey | DQUWSYFZBXCPSD-AREMUKBSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCCC[N](CCCC)(CCCC)Cc1ccc(cc1)C(c2ccccc2)O | CACTVS 3.385 | CCCC[N](CCCC)(CCCC)Cc1ccc(cc1)[CH](O)c2ccccc2 | CACTVS 3.385 | CCCC[N](CCCC)(CCCC)Cc1ccc(cc1)[C@H](O)c2ccccc2 | OpenEye OEToolkits 2.0.7 | CCCC[N](CCCC)(CCCC)Cc1ccc(cc1)[C@@H](c2ccccc2)O |
|
Formula | C26 H40 N O |
Name | (~{R})-phenyl-[4-[(tributyl-$l^{4}-azanyl)methyl]phenyl]methanol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5bkk Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|