Structure of PDB 3h03 Chain G Binding Site BS01 |
|
|
Ligand ID | UBP |
InChI | InChI=1S/C10H13N3O6/c11-6(9(17)18)5-12-3-1-7(14)13(10(12)19)4-2-8(15)16/h1,3,6H,2,4-5,11H2,(H,15,16)(H,17,18)/t6-/m0/s1 |
InChIKey | CNWDQZBURPNJRN-LURJTMIESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[CH](CN1C=CC(=O)N(CCC(O)=O)C1=O)C(O)=O | ACDLabs 10.04 | O=C(O)C(N)CN1C=CC(=O)N(C1=O)CCC(=O)O | CACTVS 3.341 | N[C@@H](CN1C=CC(=O)N(CCC(O)=O)C1=O)C(O)=O | OpenEye OEToolkits 1.5.0 | C1=CN(C(=O)N(C1=O)CCC(=O)O)CC(C(=O)O)N | OpenEye OEToolkits 1.5.0 | C1=CN(C(=O)N(C1=O)CCC(=O)O)C[C@@H](C(=O)O)N |
|
Formula | C10 H13 N3 O6 |
Name | 3-[3-(2-carboxyethyl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl]-L-alanine; (S)-1-(2-amino-2-carboxyethyl)-3-(2-carboxyethyl)pyrimidine-2,4-dione |
ChEMBL | CHEMBL200737 |
DrugBank | |
ZINC | ZINC000013677278
|
PDB chain | 3h03 Chain G Residue 804
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|