Structure of PDB 2vi5 Chain G Binding Site BS01 |
|
|
Ligand ID | Y19 |
InChI | InChI=1S/C12H20N4O7/c1-2-7(20)14-8-10(15-12(23)16-11(8)22)13-3-5(18)9(21)6(19)4-17/h5-6,8-9,17-19,21H,2-4H2,1H3,(H,14,20)(H2,13,15,16,22,23)/t5-,6+,8-,9-/m0/s1 |
InChIKey | NPNFNBTUUJYCDD-FAYXRDSDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCC(=O)NC1C(=O)NC(=O)N=C1NCC(C(C(CO)O)O)O | ACDLabs 10.04 | O=C1NC(=O)N=C(NCC(O)C(O)C(O)CO)C1NC(=O)CC | CACTVS 3.341 | CCC(=O)N[CH]1C(=O)NC(=O)N=C1NC[CH](O)[CH](O)[CH](O)CO | CACTVS 3.341 | CCC(=O)N[C@@H]1C(=O)NC(=O)N=C1NC[C@H](O)[C@H](O)[C@H](O)CO | OpenEye OEToolkits 1.5.0 | CCC(=O)N[C@@H]1C(=O)NC(=O)N=C1NC[C@@H]([C@@H]([C@@H](CO)O)O)O |
|
Formula | C12 H20 N4 O7 |
Name | 1-deoxy-1-{[(5S)-2,6-dioxo-5-(propanoylamino)-1,2,5,6-tetrahydropyrimidin-4-yl]amino}-D-ribitol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000016052607
|
PDB chain | 2vi5 Chain F Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H89 |
Catalytic site (residue number reindexed from 1) |
H76 |
Enzyme Commision number |
2.5.1.78: 6,7-dimethyl-8-ribityllumazine synthase. |
|
|
|