Structure of PDB 7cs8 Chain F Binding Site BS01 |
|
|
Ligand ID | GO6 |
InChI | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m0/s1 |
InChIKey | PUETUDUXMCLALY-HOTGVXAUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(C[CH](CO)[CH](CO)Cc2ccc(O)c(OC)c2)ccc1O | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)CC(CO)C(Cc2ccc(c(c2)OC)O)CO | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)C[C@@H](CO)[C@@H](Cc2ccc(c(c2)OC)O)CO | CACTVS 3.385 | COc1cc(C[C@@H](CO)[C@H](CO)Cc2ccc(O)c(OC)c2)ccc1O |
|
Formula | C20 H26 O6 |
Name | (2R,3R)-2,3-bis[(3-methoxy-4-oxidanyl-phenyl)methyl]butane-1,4-diol; (-)-secoisolariciresinol |
ChEMBL | CHEMBL368347 |
DrugBank | DB12179 |
ZINC | ZINC000002020114
|
PDB chain | 7cs8 Chain F Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|