Structure of PDB 6o3u Chain F Binding Site BS01 |
|
|
Ligand ID | 44E |
InChI | InChI=1S/C15H29O8P/c1-3-5-7-9-14(16)21-11-13(12-22-24(18,19)20)23-15(17)10-8-6-4-2/h13H,3-12H2,1-2H3,(H2,18,19,20)/t13-/m1/s1 |
InChIKey | SFZZRGHNPILUOD-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCCC | CACTVS 3.385 | CCCCCC(=O)OC[CH](CO[P](O)(O)=O)OC(=O)CCCCC | CACTVS 3.385 | CCCCCC(=O)OC[C@H](CO[P](O)(O)=O)OC(=O)CCCCC | ACDLabs 12.01 | O=C(OC(COP(=O)(O)O)COC(=O)CCCCC)CCCCC | OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCC |
|
Formula | C15 H29 O8 P |
Name | (2R)-3-(phosphonooxy)propane-1,2-diyl dihexanoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6o3u Chain F Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|