Structure of PDB 6n55 Chain F Binding Site BS01 |
|
|
Ligand ID | UZ0 |
InChI | InChI=1S/C9H11N5O5/c10-13-12-6-7(17)4(3-15)19-8(6)14-2-1-5(16)11-9(14)18/h1-2,4,6-8,15,17H,3H2,(H,11,16,18)/t4-,6-,7-,8-/m1/s1 |
InChIKey | MRUKYOQQKHNMFI-XVFCMESISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@H]1O[C@H]([C@H](N=[N+]=[N-])[C@@H]1O)N2C=CC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)N=[N+]=[N-] | OpenEye OEToolkits 2.0.7 | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)N=[N+]=[N-] | CACTVS 3.385 | OC[CH]1O[CH]([CH](N=[N+]=[N-])[CH]1O)N2C=CC(=O)NC2=O | ACDLabs 12.01 | N1(C=CC(NC1=O)=O)C2OC(C(C2N=[N+]=[N-])O)CO |
|
Formula | C9 H11 N5 O5 |
Name | 2'-azido-2'-deoxyuridine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000006091560
|
PDB chain | 6n55 Chain F Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.48: uridine/cytidine kinase. |
|
|
|