Structure of PDB 5uqe Chain F Binding Site BS01 |
|
|
Ligand ID | 04A |
InChI | InChI=1S/C24H24N6O2S3/c31-19(15-17-7-3-1-4-8-17)25-23-29-27-21(34-23)11-13-33-14-12-22-28-30-24(35-22)26-20(32)16-18-9-5-2-6-10-18/h1-10H,11-16H2,(H,25,29,31)(H,26,30,32) |
InChIKey | MDJIPXYRSZHCFS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C(Cc1ccccc1)Nc2sc(CCSCCc3sc(NC(=O)Cc4ccccc4)nn3)nn2 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CC(=O)Nc2nnc(s2)CCSCCc3nnc(s3)NC(=O)Cc4ccccc4 | ACDLabs 12.01 | O=C(Nc1nnc(s1)CCSCCc2nnc(s2)NC(=O)Cc3ccccc3)Cc4ccccc4 |
|
Formula | C24 H24 N6 O2 S3 |
Name | N,N'-[sulfanediylbis(ethane-2,1-diyl-1,3,4-thiadiazole-5,2-diyl)]bis(2-phenylacetamide); BPTES |
ChEMBL | CHEMBL2177757 |
DrugBank | |
ZINC | ZINC000004426660
|
PDB chain | 5uqe Chain F Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S286 |
Catalytic site (residue number reindexed from 1) |
S149 |
Enzyme Commision number |
3.5.1.2: glutaminase. |
|
|
|