Structure of PDB 5pzt Chain F Binding Site BS01 |
|
|
Ligand ID | 947 |
InChI | InChI=1S/C18H16BrN3O3S2/c1-2-12-10-14(8-9-15(12)13-6-4-3-5-7-13)27(24,25)22-17(23)21-18-20-11-16(19)26-18/h3-11H,2H2,1H3,(H2,20,21,22,23) |
InChIKey | NUXUEZJTLCTLKE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCc1cc(ccc1c2ccccc2)S(=O)(=O)NC(=O)Nc3ncc(s3)Br | ACDLabs 12.01 | C(=O)(NS(c1cc(c(cc1)c2ccccc2)CC)(=O)=O)Nc3sc(Br)cn3 | CACTVS 3.385 | CCc1cc(ccc1c2ccccc2)[S](=O)(=O)NC(=O)Nc3sc(Br)cn3 |
|
Formula | C18 H16 Br N3 O3 S2 |
Name | N-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-2-ethyl[1,1'-biphenyl]-4-sulfonamide |
ChEMBL | CHEMBL595529 |
DrugBank | |
ZINC | ZINC000045350109
|
PDB chain | 5pzt Chain F Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|