Structure of PDB 5kww Chain F Binding Site BS01 |
|
|
Ligand ID | 6YA |
InChI | InChI=1S/C21H20ClF3N4O3S/c1-33(31,32)8-2-7-27-16(10-14-9-15(22)3-4-17(14)27)12-28-19-11-26-6-5-18(19)29(20(28)30)13-21(23,24)25/h3-6,9-11H,2,7-8,12-13H2,1H3 |
InChIKey | GTQTUABHRCWVLL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[S](=O)(=O)CCCn1c(CN2C(=O)N(CC(F)(F)F)c3ccncc23)cc4cc(Cl)ccc14 | OpenEye OEToolkits 2.0.5 | CS(=O)(=O)CCCn1c2ccc(cc2cc1CN3c4cnccc4N(C3=O)CC(F)(F)F)Cl |
|
Formula | C21 H20 Cl F3 N4 O3 S |
Name | 3-[[5-chloranyl-1-(3-methylsulfonylpropyl)indol-2-yl]methyl]-1-[2,2,2-tris(fluoranyl)ethyl]imidazo[4,5-c]pyridin-2-one |
ChEMBL | CHEMBL4437054 |
DrugBank | DB15672 |
ZINC |
|
PDB chain | 5kww Chain F Residue 613
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|