Structure of PDB 4myx Chain F Binding Site BS01 |
|
|
Ligand ID | 2F0 |
InChI | InChI=1S/C19H21ClN4O3/c1-11(24-27)12-5-4-6-13(9-12)19(2,3)23-18(26)22-14-7-8-16(20)15(10-14)17(21)25/h4-10,27H,1-3H3,(H2,21,25)(H2,22,23,26)/b24-11+ |
InChIKey | NRJRCKIOCQMNMC-BHGWPJFGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=NO)c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(Cl)c(c2)C(N)=O | ACDLabs 12.01 | O=C(c1cc(ccc1Cl)NC(=O)NC(c2cccc(\C(=N\O)C)c2)(C)C)N | OpenEye OEToolkits 1.7.6 | CC(=NO)c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(c(c2)C(=O)N)Cl | OpenEye OEToolkits 1.7.6 | C/C(=N\O)/c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(c(c2)C(=O)N)Cl | CACTVS 3.385 | CC(=N\O)/c1cccc(c1)C(C)(C)NC(=O)Nc2ccc(Cl)c(c2)C(N)=O |
|
Formula | C19 H21 Cl N4 O3 |
Name | 2-chloro-5-{[(2-{3-[(1E)-N-hydroxyethanimidoyl]phenyl}propan-2-yl)carbamoyl]amino}benzamide; P32 |
ChEMBL | CHEMBL2178617 |
DrugBank | |
ZINC | ZINC000095574658
|
PDB chain | 4myx Chain E Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.205: IMP dehydrogenase. |
|
|
|