Structure of PDB 4hw3 Chain F Binding Site BS01 |
|
|
Ligand ID | 19G |
InChI | InChI=1S/C20H19ClO3S/c1-12-10-14(11-13(2)18(12)21)24-9-5-7-16-15-6-3-4-8-17(15)25-19(16)20(22)23/h3-4,6,8,10-11H,5,7,9H2,1-2H3,(H,22,23) |
InChIKey | GFWMYYSJLSUPMD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc3c(cc(OCCCc1c2ccccc2sc1C(=O)O)cc3C)C | OpenEye OEToolkits 1.7.6 | Cc1cc(cc(c1Cl)C)OCCCc2c3ccccc3sc2C(=O)O | CACTVS 3.370 | Cc1cc(OCCCc2c(sc3ccccc23)C(O)=O)cc(C)c1Cl |
|
Formula | C20 H19 Cl O3 S |
Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-benzothiophene-2-carboxylic acid |
ChEMBL | CHEMBL2314173 |
DrugBank | |
ZINC | ZINC000095543913
|
PDB chain | 4hw3 Chain F Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|