Structure of PDB 7q14 Chain EEE Binding Site BS01 |
|
|
Ligand ID | ID1 |
InChI | InChI=1S/C12H19N3O4S/c1-7(17)8(5-16)9-4-10(11(15-9)12(18)19)20-3-2-14-6-13/h5-10,17H,2-4H2,1H3,(H2,13,14)(H,18,19)/t7-,8-,9-,10-/m1/s1 |
InChIKey | NIJGFQHESQFJAG-ZYUZMQFOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](O)[CH](C=O)[CH]1C[CH](SCCN=CN)C(=N1)C(O)=O | OpenEye OEToolkits 2.0.4 | CC(C(C=O)C1CC(C(=N1)C(=O)O)SCCN=CN)O | OpenEye OEToolkits 2.0.4 | C[C@H]([C@@H](C=O)[C@H]1C[C@H](C(=N1)C(=O)O)SCC/N=C\N)O | CACTVS 3.385 | C[C@@H](O)[C@@H](C=O)[C@H]1C[C@@H](SCCN=CN)C(=N1)C(O)=O |
|
Formula | C12 H19 N3 O4 S |
Name | Imipenem |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905603
|
PDB chain | 7q14 Chain EEE Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|