Structure of PDB 6t8x Chain E Binding Site BS01 |
|
|
Ligand ID | B97 |
InChI | InChI=1S/C21H18N4OS/c1-11-3-4-13(10-22-11)15-6-5-14-16(25-15)7-8-17-18(14)19-20(27-17)21(26)24-12(2)9-23-19/h3-8,10,12,23H,9H2,1-2H3,(H,24,26)/t12-/m1/s1 |
InChIKey | CMWRPDHVGMHLSZ-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[CH]1CNc2c(sc3ccc4nc(ccc4c23)c5ccc(C)nc5)C(=O)N1 | ACDLabs 10.04 | O=C3NC(CNc2c4c1ccc(nc1ccc4sc23)c5ccc(nc5)C)C | OpenEye OEToolkits 1.5.0 | Cc1ccc(cn1)c2ccc3c(n2)ccc4c3c5c(s4)C(=O)N[C@@H](CN5)C | CACTVS 3.341 | C[C@@H]1CNc2c(sc3ccc4nc(ccc4c23)c5ccc(C)nc5)C(=O)N1 | OpenEye OEToolkits 1.5.0 | Cc1ccc(cn1)c2ccc3c(n2)ccc4c3c5c(s4)C(=O)NC(CN5)C |
|
Formula | C21 H18 N4 O S |
Name | (10R)-10-methyl-3-(6-methylpyridin-3-yl)-9,10,11,12-tetrahydro-8H-[1,4]diazepino[5',6':4,5]thieno[3,2-f]quinolin-8-one |
ChEMBL | CHEMBL1231206 |
DrugBank | DB07430 |
ZINC | ZINC000039258365
|
PDB chain | 6t8x Chain E Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|