Structure of PDB 5q01 Chain E Binding Site BS01 |
|
|
Ligand ID | 95G |
InChI | InChI=1S/C14H10BrCl2N5O4S2/c1-22-12(10(16)11(17)20-22)26-7-2-4-8(5-3-7)28(24,25)21-13(23)19-14-18-6-9(15)27-14/h2-6H,1H3,(H2,18,19,21,23) |
InChIKey | PRZBYMWCBKOTJZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1nc(Cl)c(Cl)c1Oc2ccc(cc2)[S](=O)(=O)NC(=O)Nc3sc(Br)cn3 | OpenEye OEToolkits 2.0.6 | Cn1c(c(c(n1)Cl)Cl)Oc2ccc(cc2)S(=O)(=O)NC(=O)Nc3ncc(s3)Br | ACDLabs 12.01 | c2(Oc1c(c(Cl)nn1C)Cl)ccc(cc2)S(NC(=O)Nc3sc(cn3)Br)(=O)=O |
|
Formula | C14 H10 Br Cl2 N5 O4 S2 |
Name | N-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-4-[(3,4-dichloro-1-methyl-1H-pyrazol-5-yl)oxy]benzene-1-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q01 Chain E Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|