Structure of PDB 5ke4 Chain E Binding Site BS01 |
|
|
Ligand ID | 6S7 |
InChI | InChI=1S/C16H26N4O/c1-19(2)3-4-21-16-6-15(9-18-10-16)20-11-13-5-14(12-20)8-17-7-13/h6,9-10,13-14,17H,3-5,7-8,11-12H2,1-2H3/t13-,14+ |
InChIKey | YXMGPQOPWMCEQM-OKILXGFUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | CN(C)CCOc1cc(cnc1)N2CC3CC(C2)CNC3 | CACTVS 3.385 | CN(C)CCOc1cncc(c1)N2C[CH]3CNC[CH](C3)C2 | OpenEye OEToolkits 2.0.5 | CN(C)CCOc1cc(cnc1)N2C[C@@H]3C[C@H](C2)CNC3 | CACTVS 3.385 | CN(C)CCOc1cncc(c1)N2C[C@H]3CNC[C@H](C3)C2 |
|
Formula | C16 H26 N4 O |
Name | 2-((5-(3,7-Diazabicyclo[3.3.1]nonan-3-yl)pyridin-3-yl)oxy)-N,N-dimethylethanamine; 2-[5-[(1~{R},5~{S})-3,7-diazabicyclo[3.3.1]nonan-3-yl]pyridin-3-yl]oxy-~{N},~{N}-dimethyl-ethanamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000203709712
|
PDB chain | 5ke4 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|