Structure of PDB 5est Chain E Binding Site BS01 |
|
|
Ligand ID | 0P2 |
InChI | InChI=1S/C16H25BN2O5/c1-4-11(2)14(17(22)23)19-15(20)12(3)18-16(21)24-10-13-8-6-5-7-9-13/h5-9,11-12,14,22-23H,4,10H2,1-3H3,(H,18,21)(H,19,20)/t11-,12-,14-/m0/s1 |
InChIKey | WMMGWXIYADLQHX-OBJOEFQTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | B(C(C(C)CC)NC(=O)C(C)NC(=O)OCc1ccccc1)(O)O | CACTVS 3.370 | CC[CH](C)[CH](NC(=O)[CH](C)NC(=O)OCc1ccccc1)B(O)O | OpenEye OEToolkits 1.7.0 | B([C@H]([C@@H](C)CC)NC(=O)[C@H](C)NC(=O)OCc1ccccc1)(O)O | ACDLabs 12.01 | O=C(NC(B(O)O)C(C)CC)C(NC(=O)OCc1ccccc1)C | CACTVS 3.370 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)OCc1ccccc1)B(O)O |
|
Formula | C16 H25 B N2 O5 |
Name | N~2~-[(benzyloxy)carbonyl]-N-[(1R,2S)-1-(dihydroxyboranyl)-2-methylbutyl]-L-alaninamide; ZAIB |
ChEMBL | |
DrugBank | |
ZINC | ZINC000195809831
|
PDB chain | 5est Chain E Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.36: pancreatic elastase. |
|
|
|