Structure of PDB 4e4m Chain E Binding Site BS01 |
|
|
Ligand ID | 0NH |
InChI | InChI=1S/C15H19N5O2S/c1-15(4-7-19(8-5-15)23(2,21)22)20-10-18-12-9-17-14-11(13(12)20)3-6-16-14/h3,6,9-10H,4-5,7-8H2,1-2H3,(H,16,17) |
InChIKey | NWNODCMQDYQNDW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(N4CCC(n1c2c3ccnc3ncc2nc1)(CC4)C)C | CACTVS 3.370 | CC1(CCN(CC1)[S](C)(=O)=O)n2cnc3cnc4[nH]ccc4c23 | OpenEye OEToolkits 1.7.6 | CC1(CCN(CC1)S(=O)(=O)C)n2cnc3c2c4cc[nH]c4nc3 |
|
Formula | C15 H19 N5 O2 S |
Name | 1-[4-methyl-1-(methylsulfonyl)piperidin-4-yl]-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridine |
ChEMBL | CHEMBL2152409 |
DrugBank | |
ZINC | ZINC000095575400
|
PDB chain | 4e4m Chain E Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N981 D994 |
Catalytic site (residue number reindexed from 1) |
N147 D160 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|