Structure of PDB 3w2c Chain E Binding Site BS01 |
|
|
Ligand ID | N15 |
InChI | InChI=1S/C24H25N7O/c1-15(2)9-10-25-22(32)14-31-13-17(12-26-31)16-7-8-18-21(11-16)29-30-23(18)24-27-19-5-3-4-6-20(19)28-24/h3-8,11-13,15H,9-10,14H2,1-2H3,(H,25,32)(H,27,28)(H,29,30) |
InChIKey | MBGGBSBQBVZBHN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)CCNC(=O)Cn1cc(cn1)c2ccc3c(c2)[nH]nc3c4[nH]c5ccccc5n4 | CACTVS 3.370 | CC(C)CCNC(=O)Cn1cc(cn1)c2ccc3c([nH]nc3c4[nH]c5ccccc5n4)c2 | ACDLabs 12.01 | O=C(NCCC(C)C)Cn5ncc(c1ccc2c(c1)nnc2c4nc3ccccc3n4)c5 |
|
Formula | C24 H25 N7 O |
Name | 2-{4-[3-(1H-benzimidazol-2-yl)-1H-indazol-6-yl]-1H-pyrazol-1-yl}-N-(3-methylbutyl)acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209202
|
PDB chain | 3w2c Chain E Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N261 D274 |
Catalytic site (residue number reindexed from 1) |
N112 D125 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|