Structure of PDB 1ppc Chain E Binding Site BS01 |
|
|
Ligand ID | MID |
InChI | InChI=1S/C27H31N5O4S/c28-26(29)21-10-8-19(9-11-21)16-24(27(34)32-14-4-1-5-15-32)31-25(33)18-30-37(35,36)23-13-12-20-6-2-3-7-22(20)17-23/h2-3,6-13,17,24,30H,1,4-5,14-16,18H2,(H3,28,29)(H,31,33)/t24-/m1/s1 |
InChIKey | XXTWZTPVNIYSJZ-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | [H]/N=C(/c1ccc(cc1)C[C@H](C(=O)N2CCCCC2)NC(=O)CNS(=O)(=O)c3ccc4ccccc4c3)\N | ACDLabs 10.04 | O=C(N1CCCCC1)C(NC(=O)CNS(=O)(=O)c3cc2ccccc2cc3)Cc4ccc(C(=[N@H])N)cc4 | OpenEye OEToolkits 1.5.0 | [H]N=C(c1ccc(cc1)CC(C(=O)N2CCCCC2)NC(=O)CNS(=O)(=O)c3ccc4ccccc4c3)N | CACTVS 3.341 | NC(=N)c1ccc(C[CH](NC(=O)CN[S](=O)(=O)c2ccc3ccccc3c2)C(=O)N4CCCCC4)cc1 | CACTVS 3.341 | NC(=N)c1ccc(C[C@@H](NC(=O)CN[S](=O)(=O)c2ccc3ccccc3c2)C(=O)N4CCCCC4)cc1 |
|
Formula | C27 H31 N5 O4 S |
Name | 1-[N-(naphthalen-2-ylsulfonyl)glycyl-4-carbamimidoyl-D-phenylalanyl]piperidine; NAPAP |
ChEMBL | CHEMBL51173 |
DrugBank | |
ZINC | ZINC000003807246
|
PDB chain | 1ppc Chain E Residue 5
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 1ppc Geometry of binding of the benzamidine- and arginine-based inhibitors N alpha-(2-naphthyl-sulphonyl-glycyl)-DL-p-amidinophenylalanyl-pipe ridine (NAPAP) and (2R,4R)-4-methyl-1-[N alpha-(3-methyl-1,2,3,4-tetrahydr quinolinesulphonyl)-L-arginyl]-2-piperidine carboxylic acid (MQPA) to human alpha-thrombin.X-ray crystallographic determination of the NAPAP-trypsin complex and modeling of NAPAP-thrombin and MQPA-thrombin. |
Resolution | 1.8 Å |
Binding residue (original residue number in PDB) | H57 N97 L99 D189 S190 S195 W215 G216 G219 |
Binding residue (residue number reindexed from 1) | H40 N79 L81 D171 S172 S177 W193 G194 G196 |
Annotation score | 1  |
Binding affinity | MOAD: Ki=0.69uM PDBbind-CN: -logKd/Ki=6.16,Ki=0.69uM BindingDB: Ki=325nM |
|
|
|
|
|