Structure of PDB 1lt5 Chain E Binding Site BS01 |
|
|
Ligand ID | YIO |
InChI | InChI=1S/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(12)11-2/h2-10,12H,1H2/t2-,3+,4+,5-,6+/m1/s1 |
InChIKey | JUSMHIGDXPKSID-PHYPRBDBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)S)O)O)O)O | OpenEye OEToolkits 1.6.1 | C(C1C(C(C(C(O1)S)O)O)O)O | CACTVS 3.352 | OC[C@H]1O[C@@H](S)[C@H](O)[C@@H](O)[C@H]1O | CACTVS 3.352 | OC[CH]1O[CH](S)[CH](O)[CH](O)[CH]1O |
|
Formula | C6 H12 O5 S |
Name | 1-thio-beta-D-galactopyranose; (2R,3R,4S,5R,6S)-2-(HYDROXYMETHYL)-6-SULFANYL-OXANE-3,4,5-TRIOL; 1-thio-beta-D-galactose; 1-thio-D-galactose; 1-thio-galactose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003873643
|
PDB chain | 1lt5 Chain M Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|