Structure of PDB 1efi Chain E Binding Site BS01 |
|
|
Ligand ID | GAT |
InChI | InChI=1S/C12H17NO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5,13H2/t8-,9+,10+,11-,12+/m1/s1 |
InChIKey | MIAKOEWBCMPCQR-IIRVCBMXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(ccc1N)O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O | CACTVS 3.341 | Nc1ccc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 | CACTVS 3.341 | Nc1ccc(O[CH]2O[CH](CO)[CH](O)[CH](O)[CH]2O)cc1 | OpenEye OEToolkits 1.5.0 | c1cc(ccc1N)OC2C(C(C(C(O2)CO)O)O)O | ACDLabs 10.04 | O(c1ccc(N)cc1)C2OC(C(O)C(O)C2O)CO |
|
Formula | C12 H17 N O6 |
Name | 4-aminophenyl alpha-D-galactopyranoside; 4'-AMINOPHENYL-ALPHA-D-GALACTOPYRANOSIDE; P-AMINOPHENYL-ALPHA-D-GALACTOPYRANOSIDE; 4-aminophenyl alpha-D-galactoside; 4-aminophenyl D-galactoside; 4-aminophenyl galactoside |
ChEMBL | |
DrugBank | DB03242 |
ZINC |
|
PDB chain | 1efi Chain E Residue 105
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|