Structure of PDB 7wnv Chain D Binding Site BS01 |
|
|
Ligand ID | 2I9 |
InChI | InChI=1S/C28H28N2O5S/c1-30(2)26(33)4-3-15-29-16-17-34-22-10-12-23(13-11-22)35-27-24-14-9-21(32)18-25(24)36-28(27)19-5-7-20(31)8-6-19/h3-14,18,29,31-32H,15-17H2,1-2H3/b4-3- |
InChIKey | NDTWSGVXBKXSCE-ARJAWSKDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)C(=O)C=CCNCCOc1ccc(Oc2c(sc3cc(O)ccc23)c4ccc(O)cc4)cc1 | CACTVS 3.385 | CN(C)C(=O)\C=C/CNCCOc1ccc(Oc2c(sc3cc(O)ccc23)c4ccc(O)cc4)cc1 | OpenEye OEToolkits 2.0.7 | CN(C)C(=O)C=CCNCCOc1ccc(cc1)Oc2c3ccc(cc3sc2c4ccc(cc4)O)O | OpenEye OEToolkits 2.0.7 | CN(C)C(=O)/C=C\CNCCOc1ccc(cc1)Oc2c3ccc(cc3sc2c4ccc(cc4)O)O |
|
Formula | C28 H28 N2 O5 S |
Name | (~{Z})-4-[2-[4-[[2-(4-hydroxyphenyl)-6-oxidanyl-1-benzothiophen-3-yl]oxy]phenoxy]ethylamino]-~{N},~{N}-dimethyl-but-2-enamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7wnv Chain D Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|