Structure of PDB 7t5s Chain D Binding Site BS01 |
|
|
Ligand ID | F3R |
InChI | InChI=1S/C12H20N6O2/c1-8(11(20)14-12-15-17-18-16-12)13-10(19)7-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,13,19)(H2,14,15,16,17,18,20)/t8-/m0/s1 |
InChIKey | BNGVCLIJCHQJSI-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](NC(=O)CC1CCCCC1)C(=O)Nc2[nH]nnn2 | OpenEye OEToolkits 2.0.7 | CC(C(=O)Nc1[nH]nnn1)NC(=O)CC2CCCCC2 | OpenEye OEToolkits 2.0.7 | C[C@@H](C(=O)Nc1[nH]nnn1)NC(=O)CC2CCCCC2 | CACTVS 3.385 | C[C@H](NC(=O)CC1CCCCC1)C(=O)Nc2[nH]nnn2 | ACDLabs 12.01 | O=C(Nc1nnn[NH]1)C(C)NC(=O)CC1CCCCC1 |
|
Formula | C12 H20 N6 O2 |
Name | N~2~-(cyclohexylacetyl)-N-1H-tetrazol-5-yl-L-alaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000071796054
|
PDB chain | 7t5s Chain D Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.1.129: acyl-[acyl-carrier-protein]--UDP-N-acetylglucosamine O-acyltransferase. |
|
|
|