Structure of PDB 7m93 Chain D Binding Site BS01 |
|
|
Ligand ID | YT1 |
InChI | InChI=1S/C24H38N2O/c1-27-24-14-6-12-22-20(8-5-13-23(22)24)9-7-15-25-16-18-26(19-17-25)21-10-3-2-4-11-21/h6,12,14,20-21H,2-5,7-11,13,15-19H2,1H3/t20-/m1/s1 |
InChIKey | PHRCDWVPTULQMT-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | COc1cccc2c1CCC[C@@H]2CCCN3CCN(CC3)C4CCCCC4 | CACTVS 3.385 | COc1cccc2[C@@H](CCCN3CCN(CC3)C4CCCCC4)CCCc12 | CACTVS 3.385 | COc1cccc2[CH](CCCN3CCN(CC3)C4CCCCC4)CCCc12 | OpenEye OEToolkits 2.0.7 | COc1cccc2c1CCCC2CCCN3CCN(CC3)C4CCCCC4 | ACDLabs 12.01 | COc1cccc2c1CCCC2CCCN1CCN(CC1)C1CCCCC1 |
|
Formula | C24 H38 N2 O |
Name | PB28; 1-cyclohexyl-4-{3-[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]propyl}piperazine |
ChEMBL | CHEMBL73854 |
DrugBank | |
ZINC | ZINC000022931094
|
PDB chain | 7m93 Chain D Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|