Structure of PDB 7ew0 Chain D Binding Site BS01 |
|
|
Ligand ID | JEU |
InChI | InChI=1S/C23H24N4O3/c1-14(2)29-21-9-6-15(12-16(21)13-24)23-26-22(27-30-23)19-5-3-4-18-17(19)7-8-20(18)25-10-11-28/h3-6,9,12,14,20,25,28H,7-8,10-11H2,1-2H3/t20-/m0/s1 |
InChIKey | XRVDGNKRPOAQTN-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)Oc1ccc(cc1C#N)c2nc(no2)c3cccc4c3CCC4NCCO | OpenEye OEToolkits 2.0.7 | CC(C)Oc1ccc(cc1C#N)c2nc(no2)c3cccc4c3CC[C@@H]4NCCO | CACTVS 3.385 | CC(C)Oc1ccc(cc1C#N)c2onc(n2)c3cccc4[CH](CCc34)NCCO | CACTVS 3.385 | CC(C)Oc1ccc(cc1C#N)c2onc(n2)c3cccc4[C@H](CCc34)NCCO |
|
Formula | C23 H24 N4 O3 |
Name | 5-[3-[(1~{S})-1-(2-hydroxyethylamino)-2,3-dihydro-1~{H}-inden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxy-benzenecarbonitrile |
ChEMBL | CHEMBL3707247 |
DrugBank | DB12612 |
ZINC | ZINC000116109867
|
PDB chain | 7ew0 Chain D Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|