Structure of PDB 7bju Chain D Binding Site BS01 |
|
|
Ligand ID | 834 |
InChI | InChI=1S/C23H24ClN3O3/c1-13(2)20-15(4)25-22(17-7-5-6-8-18(17)24)27(20)26-23(28)16-9-10-19-21(14(16)3)30-12-11-29-19/h5-10,13H,11-12H2,1-4H3,(H,26,28) |
InChIKey | XLNQTHXOKGRTAL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | Clc1ccccc1c2nc(c(n2NC(=O)c4ccc3OCCOc3c4C)C(C)C)C | OpenEye OEToolkits 1.7.0 | Cc1c(ccc2c1OCCO2)C(=O)Nn3c(c(nc3c4ccccc4Cl)C)C(C)C | CACTVS 3.352 | CC(C)c1n(NC(=O)c2ccc3OCCOc3c2C)c(nc1C)c4ccccc4Cl |
|
Formula | C23 H24 Cl N3 O3 |
Name | N-[2-(2-chlorophenyl)-4-methyl-5-(1-methylethyl)-1H-imidazol-1-yl]-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide; N-(2-(2-chlorophenyl)-5-isopropyl-4-methyl-1H-imidazol-1-yl)-5-methyl-2,3-dihyrobenzo[b][1,4]dioxine-6-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034391431
|
PDB chain | 7bju Chain D Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|